![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
10-4 Eleanor |
20-Apr-2018 16:20 |
- |
|
 |
34 Young Cash |
20-Apr-2018 16:20 |
- |
|
 |
7Horse |
20-Apr-2018 16:20 |
- |
|
 |
99 Souls feat. Destiny’s Child & Brandy |
20-Apr-2018 16:20 |
- |
|
 |
ALi feat. LOCO |
20-Apr-2018 16:20 |
- |
|
 |
Aaron Davis |
20-Apr-2018 16:20 |
- |
|
 |
Abigail ⁄ Black Angel |
20-Apr-2018 16:20 |
- |
|
 |
Adrian R. Smith |
20-Apr-2018 16:20 |
- |
|
 |
Alberto Fortis |
20-Apr-2018 16:20 |
- |
|
 |
Alex Diehl |
20-Apr-2018 16:20 |
- |
|
 |
Alex Goot |
20-Apr-2018 16:20 |
- |
|
 |
Alexander Köberlein |
20-Apr-2018 16:20 |
- |
|
 |
Ant Savino |
20-Apr-2018 16:20 |
- |
|
 |
Antoine Daniel |
20-Apr-2018 16:20 |
- |
|
 |
Antonín Dvořák; Klaus Tennstedt, Lorin Maazel |
20-Apr-2018 16:20 |
- |
|
 |
Arrested Cougar |
20-Apr-2018 16:20 |
- |
|
 |
Arthur Godfrey |
20-Apr-2018 16:20 |
- |
|
 |
Arthur Hanlon featuring Natalia Jiménez |
20-Apr-2018 16:20 |
- |
|
 |
Aubrey Ghent |
20-Apr-2018 16:20 |
- |
|
 |
Audun Trio |
20-Apr-2018 16:20 |
- |
|
 |
BNK ft. David Calzado y su Charanga Habanera |
20-Apr-2018 16:20 |
- |
|
 |
Bad Sister |
20-Apr-2018 16:20 |
- |
|
 |
Baldassare Galuppi; Annalisa Martella |
20-Apr-2018 16:20 |
- |
|
 |
Bedford Grove |
20-Apr-2018 16:20 |
- |
|
 |
Black Pumas |
20-Apr-2018 16:20 |
- |
|
 |
Blaxican |
20-Apr-2018 16:20 |
- |
|
 |
Blood Sound |
20-Apr-2018 16:20 |
- |
|
 |
Bobby Matos |
20-Apr-2018 16:20 |
- |
|
 |
Brandenburg |
20-Apr-2018 16:20 |
- |
|
 |
Bruce Springsteen & The E Street Band |
20-Apr-2018 16:20 |
- |
|
 |
Bruno Bavota |
20-Apr-2018 16:20 |
- |
|
 |
Bukka White |
20-Apr-2018 16:20 |
- |
|
 |
Buxxi feat. Jay Santos |
20-Apr-2018 16:20 |
- |
|
 |
C. Stewart |
20-Apr-2018 16:20 |
- |
|
 |
Café del Mundo |
20-Apr-2018 16:20 |
- |
|
 |
Callaghan |
20-Apr-2018 16:20 |
- |
|
 |
Carmen Estevez, Hernan Romero & Kestas Vaiginis |
20-Apr-2018 16:20 |
- |
|
 |
Charles‐Marie Widor; Daniel Roth |
20-Apr-2018 16:20 |
- |
|
 |
Charles‐Marie Widor; Herman van Vliet |
20-Apr-2018 16:20 |
- |
|
 |
Chemical |
20-Apr-2018 16:20 |
- |
|
 |
Cherry aka BreakNtune |
20-Apr-2018 16:20 |
- |
|
 |
Christoph Graupner; L'ensemble des Idées heureuses & Geneviève Soly |
20-Apr-2018 16:20 |
- |
|
 |
Christopher Pisk |
20-Apr-2018 16:20 |
- |
|
 |
Clint Mansell |
20-Apr-2018 16:20 |
- |
|
 |
Comacozer ⁄ Blown Out |
20-Apr-2018 16:20 |
- |
|
 |
Conscious Pilot |
20-Apr-2018 16:20 |
- |
|
 |
CoreLeoni |
20-Apr-2018 16:20 |
- |
|
 |
Cowboy Bob and the Trailer Trash |
20-Apr-2018 16:20 |
- |
|
 |
Crow Quilled Confessions |
20-Apr-2018 16:20 |
- |
|
 |
DUSTZ |
20-Apr-2018 16:20 |
- |
|
 |
Dan Aldrich |
20-Apr-2018 16:20 |
- |
|
 |
Das Hans Glicka Singers & Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Datbu |
20-Apr-2018 16:20 |
- |
|
 |
David Murray Feat. Saul Williams |
20-Apr-2018 16:20 |
- |
|
 |
David Phelps |
20-Apr-2018 16:20 |
- |
|
 |
Desert Storm |
20-Apr-2018 16:20 |
- |
|
 |
Diana Blom; Ayse Göknur Shanal, Emma Stacker, Lotte Latukefu, Kevin Hanrahan, Brett Weymark, Clive Birch, David Wickham, Diana Blom |
20-Apr-2018 16:20 |
- |
|
 |
Diana Honig |
20-Apr-2018 16:20 |
- |
|
 |
Dominant |
20-Apr-2018 16:20 |
- |
|
 |
Dvořák, Janáček; Prague Chamber Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Dvořák; Vienna Octet |
20-Apr-2018 16:20 |
- |
|
 |
Dylan Scott |
20-Apr-2018 16:20 |
- |
|
 |
Eden Ben Zaken |
20-Apr-2018 16:20 |
- |
|
 |
Egg |
20-Apr-2018 16:20 |
- |
|
 |
Elise Einarsdotter Ensemble med Lena Willemark |
20-Apr-2018 16:20 |
- |
|
 |
Ellis Meade |
20-Apr-2018 16:20 |
- |
|
 |
Elvis Costello |
20-Apr-2018 16:20 |
- |
|
 |
English Chamber Orchestra, Enrique García Asensio |
20-Apr-2018 16:20 |
- |
|
 |
Fauré, Debussy, Florentz, Alain, Robin; Louis-Noël Bestion de Camboulas |
20-Apr-2018 16:20 |
- |
|
 |
Feldub |
20-Apr-2018 16:20 |
- |
|
 |
Felix Mendelssohn-Bartholdy, Murray Perahia, Academy of St Martin in the Fields & Neville Marriner |
20-Apr-2018 16:20 |
- |
|
 |
Fleshkiller |
20-Apr-2018 16:20 |
- |
|
 |
Forever Came Calling |
20-Apr-2018 16:20 |
- |
|
 |
Franz Liszt; BBC Philharmonic, Martin Roscoe, Gianandrea Noseda, Leo Hussain |
20-Apr-2018 16:20 |
- |
|
 |
Frederic Rzewski; Ole Kiilerich |
20-Apr-2018 16:20 |
- |
|
 |
Gasmiasma |
20-Apr-2018 16:20 |
- |
|
 |
Geoffrey Downes and The New Dance Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Georg Philipp Telemann, Fabio Biondi & Europa Galante |
20-Apr-2018 16:20 |
- |
|
 |
Gianluca Grignani |
20-Apr-2018 16:20 |
- |
|
 |
Goune |
20-Apr-2018 16:20 |
- |
|
 |
Grace Kennedy |
20-Apr-2018 16:20 |
- |
|
 |
Guti |
20-Apr-2018 16:20 |
- |
|
 |
Gökhan Kırdar |
20-Apr-2018 16:20 |
- |
|
 |
Hanai (Kris Lee-Scott) |
20-Apr-2018 16:20 |
- |
|
 |
Hardkandy |
20-Apr-2018 16:20 |
- |
|
 |
Hen Ogledd |
20-Apr-2018 16:20 |
- |
|
 |
Hermóðr |
20-Apr-2018 16:20 |
- |
|
 |
Horrorscopes |
20-Apr-2018 16:20 |
- |
|
 |
Il Civetto |
20-Apr-2018 16:20 |
- |
|
 |
Il giardino armonico, Giovanni Antonini |
20-Apr-2018 16:20 |
- |
|
 |
Il mare di Ross |
20-Apr-2018 16:20 |
- |
|
 |
International Harvester |
20-Apr-2018 16:20 |
- |
|
 |
Intruder |
20-Apr-2018 16:20 |
- |
|
 |
J Balvin |
20-Apr-2018 16:20 |
- |
|
 |
J. S. Bach; Midori Seiler |
20-Apr-2018 16:20 |
- |
|
 |
J.B. Lenoir |
20-Apr-2018 16:20 |
- |
|
 |
Jefferson Starship |
20-Apr-2018 16:20 |
- |
|
 |
Jeremy Reiser |
20-Apr-2018 16:20 |
- |
|
 |
Jersey Street |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach, Páll Ísólfsson, Hafliði Hallgrímsson, Eugène Gigout, Charles‐Marie Widor, Louis Vierne; Björn Steinar Sólbergsson |
20-Apr-2018 16:20 |
- |
|
 |
John 3:14 |
20-Apr-2018 16:20 |
- |
|
 |
Jolly Jack |
20-Apr-2018 16:20 |
- |
|
 |
Jorge Y Obo - El Duo Flamenco |
20-Apr-2018 16:20 |
- |
|
 |
Josh Whelchel |
20-Apr-2018 16:20 |
- |
|
 |
Jowell y Randy feat. Alexio "La Bruja" |
20-Apr-2018 16:20 |
- |
|
 |
Juan Fernando Velasco |
20-Apr-2018 16:20 |
- |
|
 |
Judge Mercy |
20-Apr-2018 16:20 |
- |
|
 |
Julian Fuhs und sein Orchester |
20-Apr-2018 16:20 |
- |
|
 |
Justin Bieber + BloodPop® |
20-Apr-2018 16:20 |
- |
|
 |
K-Nitrate |
20-Apr-2018 16:20 |
- |
|
 |
Kazuo Yashiro, Masanaga Harada, Hajime Nomura, Sadao Watanabe |
20-Apr-2018 16:20 |
- |
|
 |
Kenny Vaughan |
20-Apr-2018 16:20 |
- |
|
 |
Kotra vs Edward Sol |
20-Apr-2018 16:20 |
- |
|
 |
Larisa Mondrusa |
20-Apr-2018 16:20 |
- |
|
 |
Le Dancing Pepa Swing Band |
20-Apr-2018 16:20 |
- |
|
 |
Lee Fields |
20-Apr-2018 16:20 |
- |
|
 |
Lenny White, Buster Williams, George Colligan, Steve Wilson |
20-Apr-2018 16:20 |
- |
|
 |
Les Frappés |
20-Apr-2018 16:20 |
- |
|
 |
Les Frères Morvan |
20-Apr-2018 16:20 |
- |
|
 |
Leslie Mendelson |
20-Apr-2018 16:20 |
- |
|
 |
Letters |
20-Apr-2018 16:20 |
- |
|
 |
Lights of Euphoria |
20-Apr-2018 16:20 |
- |
|
 |
Lisandro Aristimuño |
20-Apr-2018 16:20 |
- |
|
 |
Lolfa Binc |
20-Apr-2018 16:20 |
- |
|
 |
Low Motion Disco |
20-Apr-2018 16:20 |
- |
|
 |
Ludwig van Beethoven; Deutsche Kammerphilharmonie Bremen, Paavo Järvi |
20-Apr-2018 16:20 |
- |
|
 |
Ludwig van Beethoven; Orchester der Wiener Staatsoper, Royal Philharmonic Orchestra, Hermann Scherchen |
20-Apr-2018 16:20 |
- |
|
 |
Luigi Boccherini, Antonio Vivaldi; Yuli Turovsky, Alain Aubut, I Musici de Montréal |
20-Apr-2018 16:20 |
- |
|
 |
Lullatone |
20-Apr-2018 16:20 |
- |
|
 |
Machine Head |
20-Apr-2018 16:20 |
- |
|
 |
Maerzfeld |
20-Apr-2018 16:20 |
- |
|
 |
Mahler; Royal Philharmonic Orchestra, Vienna State Opera Orchestra, Hermann Scherchen |
20-Apr-2018 16:20 |
- |
|
 |
Malene Mortensen |
20-Apr-2018 16:20 |
- |
|
 |
Malina Moye |
20-Apr-2018 16:20 |
- |
|
 |
Maluma feat. Fifth Harmony |
20-Apr-2018 16:20 |
- |
|
 |
Marc Teicholz |
20-Apr-2018 16:20 |
- |
|
 |
Margaret Becker, Máire Brennan & Joanne Hogg |
20-Apr-2018 16:20 |
- |
|
 |
Marina Raye |
20-Apr-2018 16:20 |
- |
|
 |
Mark Ernestus meets Ben Zabo |
20-Apr-2018 16:20 |
- |
|
 |
Martinelli |
20-Apr-2018 16:20 |
- |
|
 |
McCafferty |
20-Apr-2018 16:20 |
- |
|
 |
Mechanicbeat |
20-Apr-2018 16:20 |
- |
|
 |
Michel Portal |
20-Apr-2018 16:20 |
- |
|
 |
Mister G |
20-Apr-2018 16:20 |
- |
|
 |
Morganella |
20-Apr-2018 16:20 |
- |
|
 |
Munro Leaf, Erzählerin Marthe Keller |
20-Apr-2018 16:20 |
- |
|
 |
My Useless Life |
20-Apr-2018 16:20 |
- |
|
 |
Navalm |
20-Apr-2018 16:20 |
- |
|
 |
New York Trumpet Ensemble |
20-Apr-2018 16:20 |
- |
|
 |
Nick Colionne |
20-Apr-2018 16:20 |
- |
|
 |
Nikolai Erdenko and His Gipsy Band |
20-Apr-2018 16:20 |
- |
|
 |
Noah T |
20-Apr-2018 16:20 |
- |
|
 |
Oner & Yser One |
20-Apr-2018 16:20 |
- |
|
 |
Out 2 |
20-Apr-2018 16:20 |
- |
|
 |
Overoth |
20-Apr-2018 16:20 |
- |
|
 |
Ozmium |
20-Apr-2018 16:20 |
- |
|
 |
Paco Candela |
20-Apr-2018 16:20 |
- |
|
 |
Pastor Max McKenzie-Cook |
20-Apr-2018 16:20 |
- |
|
 |
Pedro Meirelles, Eugene Hütz, Serj Tankian |
20-Apr-2018 16:20 |
- |
|
 |
Preacher |
20-Apr-2018 16:20 |
- |
|
 |
Progres 2 |
20-Apr-2018 16:20 |
- |
|
 |
Quiet the Thief |
20-Apr-2018 16:20 |
- |
|
 |
Radiator |
20-Apr-2018 16:20 |
- |
|
 |
Radio Futura |
20-Apr-2018 16:20 |
- |
|
 |
Rahsaan Roland Kirk |
20-Apr-2018 16:20 |
- |
|
 |
Ramani y Charlie Zaa |
20-Apr-2018 16:20 |
- |
|
 |
Ratt |
20-Apr-2018 16:20 |
- |
|
 |
Rhombus |
20-Apr-2018 16:20 |
- |
|
 |
Risk Relay |
20-Apr-2018 16:20 |
- |
|
 |
Robert Schumann, Clara Schumann; Patrick Messina, Fabrizio Chiovetta, Pierre Lénert |
20-Apr-2018 16:20 |
- |
|
 |
Royal Philharmonic Orchestra, Enrique Bátiz |
20-Apr-2018 16:20 |
- |
|
 |
Ryan Crosson, Tale Of Us, Aquarius Heaven |
20-Apr-2018 16:20 |
- |
|
 |
Sad City |
20-Apr-2018 16:20 |
- |
|
 |
Salamandra |
20-Apr-2018 16:20 |
- |
|
 |
Samantha Jones |
20-Apr-2018 16:20 |
- |
|
 |
Sampaguita |
20-Apr-2018 16:20 |
- |
|
 |
Schumann, Chopin, Rachmaninoff, Liszt, Saint‐Saëns, Moszkowski; Jura Margulis |
20-Apr-2018 16:20 |
- |
|
 |
Scythelord |
20-Apr-2018 16:20 |
- |
|
 |
Seprevation |
20-Apr-2018 16:20 |
- |
|
 |
Shyun |
20-Apr-2018 16:20 |
- |
|
 |
Sidiki Diabaté |
20-Apr-2018 16:20 |
- |
|
 |
Sidney York |
20-Apr-2018 16:20 |
- |
|
 |
Son of Sam |
20-Apr-2018 16:20 |
- |
|
 |
SonReal |
20-Apr-2018 16:20 |
- |
|
 |
Sonny Terry |
20-Apr-2018 16:20 |
- |
|
 |
Sonya Chagas & Sarah Leanne Streel & Lisa Maria & Trailer Trash |
20-Apr-2018 16:20 |
- |
|
 |
Spoken |
20-Apr-2018 16:20 |
- |
|
 |
Spooked |
20-Apr-2018 16:20 |
- |
|
 |
Squintaloo |
20-Apr-2018 16:20 |
- |
|
 |
Stanley Cowell Trio |
20-Apr-2018 16:20 |
- |
|
 |
Stefan Grossman ⁄ Aurora Block |
20-Apr-2018 16:20 |
- |
|
 |
Stephen Fry, Hugh Laurie, Lenny Henry, Griff Rhys Jones and Dawn French and host Clive Anderson |
20-Apr-2018 16:20 |
- |
|
 |
Steve Taylor & Some Band |
20-Apr-2018 16:20 |
- |
|
 |
Strand |
20-Apr-2018 16:20 |
- |
|
 |
Stravinksy, Borodin; Atlanta Symphony Orchestra and Chorus, Robert Shaw |
20-Apr-2018 16:20 |
- |
|
 |
Syntec |
20-Apr-2018 16:20 |
- |
|
 |
Taio Cruz featuring Kylie |
20-Apr-2018 16:20 |
- |
|
 |
Ten City Nation |
20-Apr-2018 16:20 |
- |
|
 |
Tevelision |
20-Apr-2018 16:20 |
- |
|
 |
Tha Eastsidaz |
20-Apr-2018 16:20 |
- |
|
 |
The Dirty River Boys |
20-Apr-2018 16:20 |
- |
|
 |
The ERNIE 4 |
20-Apr-2018 16:20 |
- |
|
 |
The Hysterical Injury |
20-Apr-2018 16:20 |
- |
|
 |
The Internet |
20-Apr-2018 16:20 |
- |
|
 |
The Mar‐Keys |
20-Apr-2018 16:20 |
- |
|
 |
The Mike Nock Underground |
20-Apr-2018 16:20 |
- |
|
 |
The Minx |
20-Apr-2018 16:20 |
- |
|
 |
The Mystaken |
20-Apr-2018 16:20 |
- |
|
 |
The Range |
20-Apr-2018 16:20 |
- |
|
 |
The Raspberry Heaven |
20-Apr-2018 16:20 |
- |
|
 |
The Russian Doctors |
20-Apr-2018 16:20 |
- |
|
 |
The Twisters |
20-Apr-2018 16:20 |
- |
|
 |
The Vapids |
20-Apr-2018 16:20 |
- |
|
 |
Thembi Soddell |
20-Apr-2018 16:20 |
- |
|
 |
Thomas Hampson |
20-Apr-2018 16:20 |
- |
|
 |
Three Ton Gate |
20-Apr-2018 16:20 |
- |
|
 |
Thunderbabies |
20-Apr-2018 16:20 |
- |
|
 |
Tom Howard |
20-Apr-2018 16:20 |
- |
|
 |
Tommy Schneller |
20-Apr-2018 16:20 |
- |
|
 |
Tonstörung |
20-Apr-2018 16:20 |
- |
|
 |
Tony Allen & Africa 70 |
20-Apr-2018 16:20 |
- |
|
 |
Topper Headon |
20-Apr-2018 16:20 |
- |
|
 |
Tori Handsley Trio |
20-Apr-2018 16:20 |
- |
|
 |
Towkio |
20-Apr-2018 16:20 |
- |
|
 |
Trunk |
20-Apr-2018 16:20 |
- |
|
 |
UK Subs |
20-Apr-2018 16:20 |
- |
|
 |
Ubangi Stomp |
20-Apr-2018 16:20 |
- |
|
 |
Unlike Pluto feat. Desi Valentine |
20-Apr-2018 16:20 |
- |
|
 |
Vicarious Visions Audio |
20-Apr-2018 16:20 |
- |
|
 |
Vince Ebert |
20-Apr-2018 16:20 |
- |
|
 |
W.E.N.A. |
20-Apr-2018 16:20 |
- |
|
 |
Wheels On Fire |
20-Apr-2018 16:20 |
- |
|
 |
Wiso G, Jowell & Los Percha |
20-Apr-2018 16:20 |
- |
|
 |
Wynton Marsalis Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Xavier Naidoo |
20-Apr-2018 16:20 |
- |
|
 |
Xenotaph |
20-Apr-2018 16:20 |
- |
|
 |
Yann Novak |
20-Apr-2018 16:20 |
- |
|
 |
Yigit Koc |
20-Apr-2018 16:20 |
- |
|
 |
Yuta Inoue |
20-Apr-2018 16:20 |
- |
|
 |
she |
20-Apr-2018 16:20 |
- |
|
 |
Ángela Carrasco |
20-Apr-2018 16:20 |
- |
|
 |
Ángeles |
20-Apr-2018 16:20 |
- |
|
 |
Μαρία Παπαγεωργίου |
20-Apr-2018 16:20 |
- |
|
 |
Τάσος Μπουγάς |
20-Apr-2018 16:20 |
- |
|
 |
Академический ансамбль песни и пляски Российской Армии имени А. В. Александрова |
20-Apr-2018 16:20 |
- |
|
 |
Евгений Мартынов |
20-Apr-2018 16:20 |
- |
|
 |
Игорь Фёдорович Стравинский, Сергей Сергеевич Прокофьев; Pražský komorní orchestr |
20-Apr-2018 16:20 |
- |
|
 |
Майя Кристалинская |
20-Apr-2018 16:20 |
- |
|
 |
Скрябін |
20-Apr-2018 16:20 |
- |
|
 |
坂本美雨 |
20-Apr-2018 16:20 |
- |
|
|