![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
10-4 Eleanor |
20-Apr-2018 16:20 |
- |
|
|
34 Young Cash |
20-Apr-2018 16:20 |
- |
|
|
7Horse |
20-Apr-2018 16:20 |
- |
|
|
99 Souls feat. Destiny’s Child & Brandy |
20-Apr-2018 16:20 |
- |
|
|
ALi feat. LOCO |
20-Apr-2018 16:20 |
- |
|
|
Aaron Davis |
20-Apr-2018 16:20 |
- |
|
|
Abigail ⁄ Black Angel |
20-Apr-2018 16:20 |
- |
|
|
Adrian R. Smith |
20-Apr-2018 16:20 |
- |
|
|
Alberto Fortis |
20-Apr-2018 16:20 |
- |
|
|
Alex Diehl |
20-Apr-2018 16:20 |
- |
|
|
Alex Goot |
20-Apr-2018 16:20 |
- |
|
|
Alexander Köberlein |
20-Apr-2018 16:20 |
- |
|
|
Ant Savino |
20-Apr-2018 16:20 |
- |
|
|
Antoine Daniel |
20-Apr-2018 16:20 |
- |
|
|
Antonín Dvořák; Klaus Tennstedt, Lorin Maazel |
20-Apr-2018 16:20 |
- |
|
|
Arrested Cougar |
20-Apr-2018 16:20 |
- |
|
|
Arthur Godfrey |
20-Apr-2018 16:20 |
- |
|
|
Arthur Hanlon featuring Natalia Jiménez |
20-Apr-2018 16:20 |
- |
|
|
Aubrey Ghent |
20-Apr-2018 16:20 |
- |
|
|
Audun Trio |
20-Apr-2018 16:20 |
- |
|
|
BNK ft. David Calzado y su Charanga Habanera |
20-Apr-2018 16:20 |
- |
|
|
Bad Sister |
20-Apr-2018 16:20 |
- |
|
|
Baldassare Galuppi; Annalisa Martella |
20-Apr-2018 16:20 |
- |
|
|
Bedford Grove |
20-Apr-2018 16:20 |
- |
|
|
Black Pumas |
20-Apr-2018 16:20 |
- |
|
|
Blaxican |
20-Apr-2018 16:20 |
- |
|
|
Blood Sound |
20-Apr-2018 16:20 |
- |
|
|
Bobby Matos |
20-Apr-2018 16:20 |
- |
|
|
Brandenburg |
20-Apr-2018 16:20 |
- |
|
|
Bruce Springsteen & The E Street Band |
20-Apr-2018 16:20 |
- |
|
|
Bruno Bavota |
20-Apr-2018 16:20 |
- |
|
|
Bukka White |
20-Apr-2018 16:20 |
- |
|
|
Buxxi feat. Jay Santos |
20-Apr-2018 16:20 |
- |
|
|
C. Stewart |
20-Apr-2018 16:20 |
- |
|
|
Café del Mundo |
20-Apr-2018 16:20 |
- |
|
|
Callaghan |
20-Apr-2018 16:20 |
- |
|
|
Carmen Estevez, Hernan Romero & Kestas Vaiginis |
20-Apr-2018 16:20 |
- |
|
|
Charles‐Marie Widor; Daniel Roth |
20-Apr-2018 16:20 |
- |
|
|
Charles‐Marie Widor; Herman van Vliet |
20-Apr-2018 16:20 |
- |
|
|
Chemical |
20-Apr-2018 16:20 |
- |
|
|
Cherry aka BreakNtune |
20-Apr-2018 16:20 |
- |
|
|
Christoph Graupner; L'ensemble des Idées heureuses & Geneviève Soly |
20-Apr-2018 16:20 |
- |
|
|
Christopher Pisk |
20-Apr-2018 16:20 |
- |
|
|
Clint Mansell |
20-Apr-2018 16:20 |
- |
|
|
Comacozer ⁄ Blown Out |
20-Apr-2018 16:20 |
- |
|
|
Conscious Pilot |
20-Apr-2018 16:20 |
- |
|
|
CoreLeoni |
20-Apr-2018 16:20 |
- |
|
|
Cowboy Bob and the Trailer Trash |
20-Apr-2018 16:20 |
- |
|
|
Crow Quilled Confessions |
20-Apr-2018 16:20 |
- |
|
|
DUSTZ |
20-Apr-2018 16:20 |
- |
|
|
Dan Aldrich |
20-Apr-2018 16:20 |
- |
|
|
Das Hans Glicka Singers & Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Datbu |
20-Apr-2018 16:20 |
- |
|
|
David Murray Feat. Saul Williams |
20-Apr-2018 16:20 |
- |
|
|
David Phelps |
20-Apr-2018 16:20 |
- |
|
|
Desert Storm |
20-Apr-2018 16:20 |
- |
|
|
Diana Blom; Ayse Göknur Shanal, Emma Stacker, Lotte Latukefu, Kevin Hanrahan, Brett Weymark, Clive Birch, David Wickham, Diana Blom |
20-Apr-2018 16:20 |
- |
|
|
Diana Honig |
20-Apr-2018 16:20 |
- |
|
|
Dominant |
20-Apr-2018 16:20 |
- |
|
|
Dvořák, Janáček; Prague Chamber Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Dvořák; Vienna Octet |
20-Apr-2018 16:20 |
- |
|
|
Dylan Scott |
20-Apr-2018 16:20 |
- |
|
|
Eden Ben Zaken |
20-Apr-2018 16:20 |
- |
|
|
Egg |
20-Apr-2018 16:20 |
- |
|
|
Elise Einarsdotter Ensemble med Lena Willemark |
20-Apr-2018 16:20 |
- |
|
|
Ellis Meade |
20-Apr-2018 16:20 |
- |
|
|
Elvis Costello |
20-Apr-2018 16:20 |
- |
|
|
English Chamber Orchestra, Enrique García Asensio |
20-Apr-2018 16:20 |
- |
|
|
Fauré, Debussy, Florentz, Alain, Robin; Louis-Noël Bestion de Camboulas |
20-Apr-2018 16:20 |
- |
|
|
Feldub |
20-Apr-2018 16:20 |
- |
|
|
Felix Mendelssohn-Bartholdy, Murray Perahia, Academy of St Martin in the Fields & Neville Marriner |
20-Apr-2018 16:20 |
- |
|
|
Fleshkiller |
20-Apr-2018 16:20 |
- |
|
|
Forever Came Calling |
20-Apr-2018 16:20 |
- |
|
|
Franz Liszt; BBC Philharmonic, Martin Roscoe, Gianandrea Noseda, Leo Hussain |
20-Apr-2018 16:20 |
- |
|
|
Frederic Rzewski; Ole Kiilerich |
20-Apr-2018 16:20 |
- |
|
|
Gasmiasma |
20-Apr-2018 16:20 |
- |
|
|
Geoffrey Downes and The New Dance Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Georg Philipp Telemann, Fabio Biondi & Europa Galante |
20-Apr-2018 16:20 |
- |
|
|
Gianluca Grignani |
20-Apr-2018 16:20 |
- |
|
|
Goune |
20-Apr-2018 16:20 |
- |
|
|
Grace Kennedy |
20-Apr-2018 16:20 |
- |
|
|
Guti |
20-Apr-2018 16:20 |
- |
|
|
Gökhan Kırdar |
20-Apr-2018 16:20 |
- |
|
|
Hanai (Kris Lee-Scott) |
20-Apr-2018 16:20 |
- |
|
|
Hardkandy |
20-Apr-2018 16:20 |
- |
|
|
Hen Ogledd |
20-Apr-2018 16:20 |
- |
|
|
Hermóðr |
20-Apr-2018 16:20 |
- |
|
|
Horrorscopes |
20-Apr-2018 16:20 |
- |
|
|
Il Civetto |
20-Apr-2018 16:20 |
- |
|
|
Il giardino armonico, Giovanni Antonini |
20-Apr-2018 16:20 |
- |
|
|
Il mare di Ross |
20-Apr-2018 16:20 |
- |
|
|
International Harvester |
20-Apr-2018 16:20 |
- |
|
|
Intruder |
20-Apr-2018 16:20 |
- |
|
|
J Balvin |
20-Apr-2018 16:20 |
- |
|
|
J. S. Bach; Midori Seiler |
20-Apr-2018 16:20 |
- |
|
|
J.B. Lenoir |
20-Apr-2018 16:20 |
- |
|
|
Jefferson Starship |
20-Apr-2018 16:20 |
- |
|
|
Jeremy Reiser |
20-Apr-2018 16:20 |
- |
|
|
Jersey Street |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach, Páll Ísólfsson, Hafliði Hallgrímsson, Eugène Gigout, Charles‐Marie Widor, Louis Vierne; Björn Steinar Sólbergsson |
20-Apr-2018 16:20 |
- |
|
|
John 3:14 |
20-Apr-2018 16:20 |
- |
|
|
Jolly Jack |
20-Apr-2018 16:20 |
- |
|
|
Jorge Y Obo - El Duo Flamenco |
20-Apr-2018 16:20 |
- |
|
|
Josh Whelchel |
20-Apr-2018 16:20 |
- |
|
|
Jowell y Randy feat. Alexio "La Bruja" |
20-Apr-2018 16:20 |
- |
|
|
Juan Fernando Velasco |
20-Apr-2018 16:20 |
- |
|
|
Judge Mercy |
20-Apr-2018 16:20 |
- |
|
|
Julian Fuhs und sein Orchester |
20-Apr-2018 16:20 |
- |
|
|
Justin Bieber + BloodPop® |
20-Apr-2018 16:20 |
- |
|
|
K-Nitrate |
20-Apr-2018 16:20 |
- |
|
|
Kazuo Yashiro, Masanaga Harada, Hajime Nomura, Sadao Watanabe |
20-Apr-2018 16:20 |
- |
|
|
Kenny Vaughan |
20-Apr-2018 16:20 |
- |
|
|
Kotra vs Edward Sol |
20-Apr-2018 16:20 |
- |
|
|
Larisa Mondrusa |
20-Apr-2018 16:20 |
- |
|
|
Le Dancing Pepa Swing Band |
20-Apr-2018 16:20 |
- |
|
|
Lee Fields |
20-Apr-2018 16:20 |
- |
|
|
Lenny White, Buster Williams, George Colligan, Steve Wilson |
20-Apr-2018 16:20 |
- |
|
|
Les Frappés |
20-Apr-2018 16:20 |
- |
|
|
Les Frères Morvan |
20-Apr-2018 16:20 |
- |
|
|
Leslie Mendelson |
20-Apr-2018 16:20 |
- |
|
|
Letters |
20-Apr-2018 16:20 |
- |
|
|
Lights of Euphoria |
20-Apr-2018 16:20 |
- |
|
|
Lisandro Aristimuño |
20-Apr-2018 16:20 |
- |
|
|
Lolfa Binc |
20-Apr-2018 16:20 |
- |
|
|
Low Motion Disco |
20-Apr-2018 16:20 |
- |
|
|
Ludwig van Beethoven; Deutsche Kammerphilharmonie Bremen, Paavo Järvi |
20-Apr-2018 16:20 |
- |
|
|
Ludwig van Beethoven; Orchester der Wiener Staatsoper, Royal Philharmonic Orchestra, Hermann Scherchen |
20-Apr-2018 16:20 |
- |
|
|
Luigi Boccherini, Antonio Vivaldi; Yuli Turovsky, Alain Aubut, I Musici de Montréal |
20-Apr-2018 16:20 |
- |
|
|
Lullatone |
20-Apr-2018 16:20 |
- |
|
|
Machine Head |
20-Apr-2018 16:20 |
- |
|
|
Maerzfeld |
20-Apr-2018 16:20 |
- |
|
|
Mahler; Royal Philharmonic Orchestra, Vienna State Opera Orchestra, Hermann Scherchen |
20-Apr-2018 16:20 |
- |
|
|
Malene Mortensen |
20-Apr-2018 16:20 |
- |
|
|
Malina Moye |
20-Apr-2018 16:20 |
- |
|
|
Maluma feat. Fifth Harmony |
20-Apr-2018 16:20 |
- |
|
|
Marc Teicholz |
20-Apr-2018 16:20 |
- |
|
|
Margaret Becker, Máire Brennan & Joanne Hogg |
20-Apr-2018 16:20 |
- |
|
|
Marina Raye |
20-Apr-2018 16:20 |
- |
|
|
Mark Ernestus meets Ben Zabo |
20-Apr-2018 16:20 |
- |
|
|
Martinelli |
20-Apr-2018 16:20 |
- |
|
|
McCafferty |
20-Apr-2018 16:20 |
- |
|
|
Mechanicbeat |
20-Apr-2018 16:20 |
- |
|
|
Michel Portal |
20-Apr-2018 16:20 |
- |
|
|
Mister G |
20-Apr-2018 16:20 |
- |
|
|
Morganella |
20-Apr-2018 16:20 |
- |
|
|
Munro Leaf, Erzählerin Marthe Keller |
20-Apr-2018 16:20 |
- |
|
|
My Useless Life |
20-Apr-2018 16:20 |
- |
|
|
Navalm |
20-Apr-2018 16:20 |
- |
|
|
New York Trumpet Ensemble |
20-Apr-2018 16:20 |
- |
|
|
Nick Colionne |
20-Apr-2018 16:20 |
- |
|
|
Nikolai Erdenko and His Gipsy Band |
20-Apr-2018 16:20 |
- |
|
|
Noah T |
20-Apr-2018 16:20 |
- |
|
|
Oner & Yser One |
20-Apr-2018 16:20 |
- |
|
|
Out 2 |
20-Apr-2018 16:20 |
- |
|
|
Overoth |
20-Apr-2018 16:20 |
- |
|
|
Ozmium |
20-Apr-2018 16:20 |
- |
|
|
Paco Candela |
20-Apr-2018 16:20 |
- |
|
|
Pastor Max McKenzie-Cook |
20-Apr-2018 16:20 |
- |
|
|
Pedro Meirelles, Eugene Hütz, Serj Tankian |
20-Apr-2018 16:20 |
- |
|
|
Preacher |
20-Apr-2018 16:20 |
- |
|
|
Progres 2 |
20-Apr-2018 16:20 |
- |
|
|
Quiet the Thief |
20-Apr-2018 16:20 |
- |
|
|
Radiator |
20-Apr-2018 16:20 |
- |
|
|
Radio Futura |
20-Apr-2018 16:20 |
- |
|
|
Rahsaan Roland Kirk |
20-Apr-2018 16:20 |
- |
|
|
Ramani y Charlie Zaa |
20-Apr-2018 16:20 |
- |
|
|
Ratt |
20-Apr-2018 16:20 |
- |
|
|
Rhombus |
20-Apr-2018 16:20 |
- |
|
|
Risk Relay |
20-Apr-2018 16:20 |
- |
|
|
Robert Schumann, Clara Schumann; Patrick Messina, Fabrizio Chiovetta, Pierre Lénert |
20-Apr-2018 16:20 |
- |
|
|
Royal Philharmonic Orchestra, Enrique Bátiz |
20-Apr-2018 16:20 |
- |
|
|
Ryan Crosson, Tale Of Us, Aquarius Heaven |
20-Apr-2018 16:20 |
- |
|
|
Sad City |
20-Apr-2018 16:20 |
- |
|
|
Salamandra |
20-Apr-2018 16:20 |
- |
|
|
Samantha Jones |
20-Apr-2018 16:20 |
- |
|
|
Sampaguita |
20-Apr-2018 16:20 |
- |
|
|
Schumann, Chopin, Rachmaninoff, Liszt, Saint‐Saëns, Moszkowski; Jura Margulis |
20-Apr-2018 16:20 |
- |
|
|
Scythelord |
20-Apr-2018 16:20 |
- |
|
|
Seprevation |
20-Apr-2018 16:20 |
- |
|
|
Shyun |
20-Apr-2018 16:20 |
- |
|
|
Sidiki Diabaté |
20-Apr-2018 16:20 |
- |
|
|
Sidney York |
20-Apr-2018 16:20 |
- |
|
|
Son of Sam |
20-Apr-2018 16:20 |
- |
|
|
SonReal |
20-Apr-2018 16:20 |
- |
|
|
Sonny Terry |
20-Apr-2018 16:20 |
- |
|
|
Sonya Chagas & Sarah Leanne Streel & Lisa Maria & Trailer Trash |
20-Apr-2018 16:20 |
- |
|
|
Spoken |
20-Apr-2018 16:20 |
- |
|
|
Spooked |
20-Apr-2018 16:20 |
- |
|
|
Squintaloo |
20-Apr-2018 16:20 |
- |
|
|
Stanley Cowell Trio |
20-Apr-2018 16:20 |
- |
|
|
Stefan Grossman ⁄ Aurora Block |
20-Apr-2018 16:20 |
- |
|
|
Stephen Fry, Hugh Laurie, Lenny Henry, Griff Rhys Jones and Dawn French and host Clive Anderson |
20-Apr-2018 16:20 |
- |
|
|
Steve Taylor & Some Band |
20-Apr-2018 16:20 |
- |
|
|
Strand |
20-Apr-2018 16:20 |
- |
|
|
Stravinksy, Borodin; Atlanta Symphony Orchestra and Chorus, Robert Shaw |
20-Apr-2018 16:20 |
- |
|
|
Syntec |
20-Apr-2018 16:20 |
- |
|
|
Taio Cruz featuring Kylie |
20-Apr-2018 16:20 |
- |
|
|
Ten City Nation |
20-Apr-2018 16:20 |
- |
|
|
Tevelision |
20-Apr-2018 16:20 |
- |
|
|
Tha Eastsidaz |
20-Apr-2018 16:20 |
- |
|
|
The Dirty River Boys |
20-Apr-2018 16:20 |
- |
|
|
The ERNIE 4 |
20-Apr-2018 16:20 |
- |
|
|
The Hysterical Injury |
20-Apr-2018 16:20 |
- |
|
|
The Internet |
20-Apr-2018 16:20 |
- |
|
|
The Mar‐Keys |
20-Apr-2018 16:20 |
- |
|
|
The Mike Nock Underground |
20-Apr-2018 16:20 |
- |
|
|
The Minx |
20-Apr-2018 16:20 |
- |
|
|
The Mystaken |
20-Apr-2018 16:20 |
- |
|
|
The Range |
20-Apr-2018 16:20 |
- |
|
|
The Raspberry Heaven |
20-Apr-2018 16:20 |
- |
|
|
The Russian Doctors |
20-Apr-2018 16:20 |
- |
|
|
The Twisters |
20-Apr-2018 16:20 |
- |
|
|
The Vapids |
20-Apr-2018 16:20 |
- |
|
|
Thembi Soddell |
20-Apr-2018 16:20 |
- |
|
|
Thomas Hampson |
20-Apr-2018 16:20 |
- |
|
|
Three Ton Gate |
20-Apr-2018 16:20 |
- |
|
|
Thunderbabies |
20-Apr-2018 16:20 |
- |
|
|
Tom Howard |
20-Apr-2018 16:20 |
- |
|
|
Tommy Schneller |
20-Apr-2018 16:20 |
- |
|
|
Tonstörung |
20-Apr-2018 16:20 |
- |
|
|
Tony Allen & Africa 70 |
20-Apr-2018 16:20 |
- |
|
|
Topper Headon |
20-Apr-2018 16:20 |
- |
|
|
Tori Handsley Trio |
20-Apr-2018 16:20 |
- |
|
|
Towkio |
20-Apr-2018 16:20 |
- |
|
|
Trunk |
20-Apr-2018 16:20 |
- |
|
|
UK Subs |
20-Apr-2018 16:20 |
- |
|
|
Ubangi Stomp |
20-Apr-2018 16:20 |
- |
|
|
Unlike Pluto feat. Desi Valentine |
20-Apr-2018 16:20 |
- |
|
|
Vicarious Visions Audio |
20-Apr-2018 16:20 |
- |
|
|
Vince Ebert |
20-Apr-2018 16:20 |
- |
|
|
W.E.N.A. |
20-Apr-2018 16:20 |
- |
|
|
Wheels On Fire |
20-Apr-2018 16:20 |
- |
|
|
Wiso G, Jowell & Los Percha |
20-Apr-2018 16:20 |
- |
|
|
Wynton Marsalis Quartet |
20-Apr-2018 16:20 |
- |
|
|
Xavier Naidoo |
20-Apr-2018 16:20 |
- |
|
|
Xenotaph |
20-Apr-2018 16:20 |
- |
|
|
Yann Novak |
20-Apr-2018 16:20 |
- |
|
|
Yigit Koc |
20-Apr-2018 16:20 |
- |
|
|
Yuta Inoue |
20-Apr-2018 16:20 |
- |
|
|
she |
20-Apr-2018 16:20 |
- |
|
|
Ángela Carrasco |
20-Apr-2018 16:20 |
- |
|
|
Ángeles |
20-Apr-2018 16:20 |
- |
|
|
Μαρία Παπαγεωργίου |
20-Apr-2018 16:20 |
- |
|
|
Τάσος Μπουγάς |
20-Apr-2018 16:20 |
- |
|
|
Академический ансамбль песни и пляски Российской Армии имени А. В. Александрова |
20-Apr-2018 16:20 |
- |
|
|
Евгений Мартынов |
20-Apr-2018 16:20 |
- |
|
|
Игорь Фёдорович Стравинский, Сергей Сергеевич Прокофьев; Pražský komorní orchestr |
20-Apr-2018 16:20 |
- |
|
|
Майя Кристалинская |
20-Apr-2018 16:20 |
- |
|
|
Скрябін |
20-Apr-2018 16:20 |
- |
|
|
坂本美雨 |
20-Apr-2018 16:20 |
- |
|
|
|---|